About 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione
2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione (PubChem CID 70625430) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione.
Molecular Properties
| Compound Name | 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione |
| PubChem CID | 70625430 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione |
| SMILES | CN(C)CCCN1C(=O)c2ccccc2C2(CCC(O)CC2)C1=O |
| InChI | InChI=1S/C19H26N2O3/c1-20(2)12-5-13-21-17(23)15-6-3-4-7-16(15)19(18(21)24)10-8-14(22)9-11-19/h3-4,6-7,14,22H,5,8-13H2,1-2H3 |
| InChIKey | VFSQKSRZDUITJA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione?
The IUPAC name of 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione (CID 70625430) is 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione.
What is the SMILES notation for 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione?
The canonical SMILES for 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione is CN(C)CCCN1C(=O)c2ccccc2C2(CCC(O)CC2)C1=O.
What is the InChIKey of 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione?
The InChIKey is VFSQKSRZDUITJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-20(2)12-5-13-21-17(23)15-6-3-4-7-16(15)19(18(21)24)10-8-14(22)9-11-19/h3-4,6-7,14,22H,5,8-13H2,1-2H3.
What are the key properties of 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione?
2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione has a molecular weight of 330.43 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-[3-(dimethylamino)propyl]-4-hydroxyspiro[cyclohexane-1,4'-isoquinoline]-1',3'-dione is sourced from PubChem (CID 70625430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).