C50H47N5O2 — CID 70626479
5-(Dimethylamino)-3,3,4,6-tetrakis(1,2-dimethylindol-3-yl)-2-benzofuran-1-one (PubChem CID 70626479) has the molecular formula C50H47N5O2 and a molecular weight of 749.90 g/mol. Its IUPAC name is 5-(dimethylamino)-3,3,4,6-tetrakis(1,2-dimethylindol-3-yl)-2-benzofuran-1-one.
| Compound Name | 5-(Dimethylamino)-3,3,4,6-tetrakis(1,2-dimethylindol-3-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 70626479 |
| Molecular Formula | C50H47N5O2 |
| Molecular Weight | 749.90 g/mol |
| Exact Mass | 749.37 |
| IUPAC Name | 5-(dimethylamino)-3,3,4,6-tetrakis(1,2-dimethylindol-3-yl)-2-benzofuran-1-one |
| SMILES | CC1=C(C2=CC=CC=C2N1C)C3=CC4=C(C(=C3N(C)C)C5=C(N(C6=CC=CC=C65)C)C)C(OC4=O)(C7=C(N(C8=CC=CC=C87)C)C)C9=C(N(C1=CC=CC=C19)C)C |
| InChI | InChI=1S/C50H47N5O2/c1-28-42(32-19-11-15-23-38(32)52(28)7)36-27-37-47(44(48(36)51(5)6)43-29(2)53(8)39-24-16-12-20-33(39)43)50(57-49(37)56,45-30(3)54(9)40-25-17-13-21-34(40)45)46-31(4)55(10)41-26-18-14-22-35(41)46/h11-27H,1-10H3 |
| InChIKey | MELBMWTWUFQSAX-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 49.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | 1450 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.90 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |