About dichlorocobalt;oxolane-2-carboxylic acid
dichlorocobalt;oxolane-2-carboxylic acid (PubChem CID 70626660) has the molecular formula C5H8Cl2CoO3
and a molecular weight of 245.95 g/mol. Its IUPAC name is dichlorocobalt;oxolane-2-carboxylic acid.
Molecular Properties
| Compound Name | dichlorocobalt;oxolane-2-carboxylic acid |
| PubChem CID | 70626660 |
| Molecular Formula | C5H8Cl2CoO3 |
| Molecular Weight | 245.95 g/mol |
| Exact Mass | 244.92 |
| IUPAC Name | dichlorocobalt;oxolane-2-carboxylic acid |
| SMILES | Cl[Co]Cl.O=C(O)C1CCCO1 |
| InChI | InChI=1S/C5H8O3.2ClH.Co/c6-5(7)4-2-1-3-8-4;;;/h4H,1-3H2,(H,6,7);2*1H;/q;;;+2/p-2 |
| InChIKey | UBKIBKPSIOJMMC-UHFFFAOYSA-L |
| XLogP | 1.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.95 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichlorocobalt;oxolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocobalt;oxolane-2-carboxylic acid?
The IUPAC name of dichlorocobalt;oxolane-2-carboxylic acid (CID 70626660) is dichlorocobalt;oxolane-2-carboxylic acid.
What is the SMILES notation for dichlorocobalt;oxolane-2-carboxylic acid?
The canonical SMILES for dichlorocobalt;oxolane-2-carboxylic acid is Cl[Co]Cl.O=C(O)C1CCCO1.
What is the InChIKey of dichlorocobalt;oxolane-2-carboxylic acid?
The InChIKey is UBKIBKPSIOJMMC-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H8O3.2ClH.Co/c6-5(7)4-2-1-3-8-4;;;/h4H,1-3H2,(H,6,7);2*1H;/q;;;+2/p-2.
What are the key properties of dichlorocobalt;oxolane-2-carboxylic acid?
dichlorocobalt;oxolane-2-carboxylic acid has a molecular weight of 245.95 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocobalt;oxolane-2-carboxylic acid is sourced from PubChem (CID 70626660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).