C17H22ClNO2 — CID 70626788
2-(4-chloro-2,5-dimethylphenoxy)-N-(3-methylbut-1-ynyl)butanamide (PubChem CID 70626788) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethylphenoxy)-N-(3-methylbut-1-ynyl)butanamide.
| Compound Name | 2-(4-chloro-2,5-dimethylphenoxy)-N-(3-methylbut-1-ynyl)butanamide |
|---|---|
| PubChem CID | 70626788 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-(4-chloro-2,5-dimethylphenoxy)-N-(3-methylbut-1-ynyl)butanamide |
| SMILES | CCC(Oc1cc(C)c(Cl)cc1C)C(=O)NC#CC(C)C |
| InChI | InChI=1S/C17H22ClNO2/c1-6-15(17(20)19-8-7-11(2)3)21-16-10-12(4)14(18)9-13(16)5/h9-11,15H,6H2,1-5H3,(H,19,20) |
| InChIKey | WBWKWXZMDAYXMU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|