About 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride
4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride (PubChem CID 70626792) has the molecular formula C7H8ClNO
and a molecular weight of 157.60 g/mol. Its IUPAC name is 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride.
Molecular Properties
| Compound Name | 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride |
| PubChem CID | 70626792 |
| Molecular Formula | C7H8ClNO |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride |
| SMILES | Cl.[H]/N=C1\C=CC(=O)C(C)=C1 |
| InChI | InChI=1S/C7H7NO.ClH/c1-5-4-6(8)2-3-7(5)9;/h2-4,8H,1H3;1H/b8-6+; |
| InChIKey | QMTDYSURRVIJIV-WVLIHFOGSA-N |
| XLogP | 1.51 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride?
The IUPAC name of 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride (CID 70626792) is 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride.
What is the SMILES notation for 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride?
The canonical SMILES for 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride is Cl.[H]/N=C1\C=CC(=O)C(C)=C1.
What is the InChIKey of 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride?
The InChIKey is QMTDYSURRVIJIV-WVLIHFOGSA-N. The full InChI is InChI=1S/C7H7NO.ClH/c1-5-4-6(8)2-3-7(5)9;/h2-4,8H,1H3;1H/b8-6+;.
What are the key properties of 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride?
4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride has a molecular weight of 157.60 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-2-methylcyclohexa-2,5-dien-1-one;hydrochloride is sourced from PubChem (CID 70626792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).