C18H25Cl — CID 70627056
6-(chloromethyl)-1,1,4,4-tetramethyl-7-prop-2-enyl-2,3-dihydronaphthalene (PubChem CID 70627056) has the molecular formula C18H25Cl and a molecular weight of 276.85 g/mol. Its IUPAC name is 6-(chloromethyl)-1,1,4,4-tetramethyl-7-prop-2-enyl-2,3-dihydronaphthalene.
| Compound Name | 6-(chloromethyl)-1,1,4,4-tetramethyl-7-prop-2-enyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 70627056 |
| Molecular Formula | C18H25Cl |
| Molecular Weight | 276.85 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-(chloromethyl)-1,1,4,4-tetramethyl-7-prop-2-enyl-2,3-dihydronaphthalene |
| SMILES | C=CCc1cc2c(cc1CCl)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C18H25Cl/c1-6-7-13-10-15-16(11-14(13)12-19)18(4,5)9-8-17(15,2)3/h6,10-11H,1,7-9,12H2,2-5H3 |
| InChIKey | FSSFZYFOPPLFBZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.85 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|