C10H13NO2 — CID 70627489
3-amino-2,5-diethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 70627489) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-amino-2,5-diethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-amino-2,5-diethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 70627489 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3-amino-2,5-diethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCC1=CC(=O)C(CC)=C(N)C1=O |
| InChI | InChI=1S/C10H13NO2/c1-3-6-5-8(12)7(4-2)9(11)10(6)13/h5H,3-4,11H2,1-2H3 |
| InChIKey | GQJUKBNSWPIXAV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|