About 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine
2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine (PubChem CID 70627569) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine |
| PubChem CID | 70627569 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine |
| SMILES | C(Oc1nccs1)=C1NCCO1 |
| InChI | InChI=1S/C7H8N2O2S/c1-3-10-6(8-1)5-11-7-9-2-4-12-7/h2,4-5,8H,1,3H2 |
| InChIKey | KUGDGIKAMJJAFM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine?
The IUPAC name of 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine (CID 70627569) is 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine.
What is the SMILES notation for 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine?
The canonical SMILES for 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine is C(Oc1nccs1)=C1NCCO1.
What is the InChIKey of 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine?
The InChIKey is KUGDGIKAMJJAFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c1-3-10-6(8-1)5-11-7-9-2-4-12-7/h2,4-5,8H,1,3H2.
What are the key properties of 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine?
2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine has a molecular weight of 184.22 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yloxymethylidene)-1,3-oxazolidine is sourced from PubChem (CID 70627569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).