About azetidin-2-amine;trimethoxy(2-methylpropyl)silane
azetidin-2-amine;trimethoxy(2-methylpropyl)silane (PubChem CID 70627585) has the molecular formula C10H26N2O3Si
and a molecular weight of 250.41 g/mol. Its IUPAC name is azetidin-2-amine;trimethoxy(2-methylpropyl)silane.
Molecular Properties
| Compound Name | azetidin-2-amine;trimethoxy(2-methylpropyl)silane |
| PubChem CID | 70627585 |
| Molecular Formula | C10H26N2O3Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | azetidin-2-amine;trimethoxy(2-methylpropyl)silane |
| SMILES | CO[Si](CC(C)C)(OC)OC.NC1CCN1 |
| InChI | InChI=1S/C7H18O3Si.C3H8N2/c1-7(2)6-11(8-3,9-4)10-5;4-3-1-2-5-3/h7H,6H2,1-5H3;3,5H,1-2,4H2 |
| InChIKey | AQPQKXGEXXXEOJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azetidin-2-amine;trimethoxy(2-methylpropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-2-amine;trimethoxy(2-methylpropyl)silane?
The IUPAC name of azetidin-2-amine;trimethoxy(2-methylpropyl)silane (CID 70627585) is azetidin-2-amine;trimethoxy(2-methylpropyl)silane.
What is the SMILES notation for azetidin-2-amine;trimethoxy(2-methylpropyl)silane?
The canonical SMILES for azetidin-2-amine;trimethoxy(2-methylpropyl)silane is CO[Si](CC(C)C)(OC)OC.NC1CCN1.
What is the InChIKey of azetidin-2-amine;trimethoxy(2-methylpropyl)silane?
The InChIKey is AQPQKXGEXXXEOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O3Si.C3H8N2/c1-7(2)6-11(8-3,9-4)10-5;4-3-1-2-5-3/h7H,6H2,1-5H3;3,5H,1-2,4H2.
What are the key properties of azetidin-2-amine;trimethoxy(2-methylpropyl)silane?
azetidin-2-amine;trimethoxy(2-methylpropyl)silane has a molecular weight of 250.41 g/mol, XLogP of 0.79, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-2-amine;trimethoxy(2-methylpropyl)silane is sourced from PubChem (CID 70627585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).