C11H11Cl2N5 — CID 70627722
N-(2,5-dichlorophenyl)-N,N'-dimethyl-1,2,4-triazole-4-carboximidamide (PubChem CID 70627722) has the molecular formula C11H11Cl2N5 and a molecular weight of 284.15 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-N,N'-dimethyl-1,2,4-triazole-4-carboximidamide.
| Compound Name | N-(2,5-dichlorophenyl)-N,N'-dimethyl-1,2,4-triazole-4-carboximidamide |
|---|---|
| PubChem CID | 70627722 |
| Molecular Formula | C11H11Cl2N5 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-N,N'-dimethyl-1,2,4-triazole-4-carboximidamide |
| SMILES | C/N=C(/N(C)c1cc(Cl)ccc1Cl)n1cnnc1 |
| InChI | InChI=1S/C11H11Cl2N5/c1-14-11(18-6-15-16-7-18)17(2)10-5-8(12)3-4-9(10)13/h3-7H,1-2H3/b14-11- |
| InChIKey | YJMQORIGHPOEFQ-KAMYIIQDSA-N |
| XLogP | 2.56 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|