About CID 70628268
CID 70628268 (PubChem CID 70628268) has the molecular formula C8H9AlClO
and a molecular weight of 183.59 g/mol.
Molecular Properties
| Compound Name | CID 70628268 |
| PubChem CID | 70628268 |
| Molecular Formula | C8H9AlClO |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | — |
| SMILES | CCc1ccccc1OCl.[Al] |
| InChI | InChI=1S/C8H9ClO.Al/c1-2-7-5-3-4-6-8(7)10-9;/h3-6H,2H2,1H3; |
| InChIKey | KCLXJJLQFPOHOO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 70628268 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70628268?
The IUPAC name of CID 70628268 (CID 70628268) is not available.
What is the SMILES notation for CID 70628268?
The canonical SMILES for CID 70628268 is CCc1ccccc1OCl.[Al].
What is the InChIKey of CID 70628268?
The InChIKey is KCLXJJLQFPOHOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO.Al/c1-2-7-5-3-4-6-8(7)10-9;/h3-6H,2H2,1H3;.
What are the key properties of CID 70628268?
CID 70628268 has a molecular weight of 183.59 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70628268 is sourced from PubChem (CID 70628268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).