C17H24O6 — CID 70628385
cyclopropane;2-methoxycarbonyl-4-(2-methylpropanoyl)furan-3-carboxylic acid (PubChem CID 70628385) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is cyclopropane;2-methoxycarbonyl-4-(2-methylpropanoyl)furan-3-carboxylic acid.
| Compound Name | cyclopropane;2-methoxycarbonyl-4-(2-methylpropanoyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 70628385 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | cyclopropane;2-methoxycarbonyl-4-(2-methylpropanoyl)furan-3-carboxylic acid |
| SMILES | C1CC1.C1CC1.COC(=O)c1occ(C(=O)C(C)C)c1C(=O)O |
| InChI | InChI=1S/C11H12O6.2C3H6/c1-5(2)8(12)6-4-17-9(11(15)16-3)7(6)10(13)14;2*1-2-3-1/h4-5H,1-3H3,(H,13,14);2*1-3H2 |
| InChIKey | PWBRRCVPWDJIQD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |