About 2-(nitromethyl)azepane
2-(nitromethyl)azepane (PubChem CID 70628611) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(nitromethyl)azepane.
Molecular Properties
| Compound Name | 2-(nitromethyl)azepane |
| PubChem CID | 70628611 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-(nitromethyl)azepane |
| SMILES | O=[N+]([O-])CC1CCCCCN1 |
| InChI | InChI=1S/C7H14N2O2/c10-9(11)6-7-4-2-1-3-5-8-7/h7-8H,1-6H2 |
| InChIKey | WCTGTXVJNALSJW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(nitromethyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(nitromethyl)azepane?
The IUPAC name of 2-(nitromethyl)azepane (CID 70628611) is 2-(nitromethyl)azepane.
What is the SMILES notation for 2-(nitromethyl)azepane?
The canonical SMILES for 2-(nitromethyl)azepane is O=[N+]([O-])CC1CCCCCN1.
What is the InChIKey of 2-(nitromethyl)azepane?
The InChIKey is WCTGTXVJNALSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c10-9(11)6-7-4-2-1-3-5-8-7/h7-8H,1-6H2.
What are the key properties of 2-(nitromethyl)azepane?
2-(nitromethyl)azepane has a molecular weight of 158.20 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(nitromethyl)azepane is sourced from PubChem (CID 70628611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).