About 2-cyclohexa-2,4-dien-1-ylideneimidazole
2-cyclohexa-2,4-dien-1-ylideneimidazole (PubChem CID 70629609) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-ylideneimidazole.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-ylideneimidazole |
| PubChem CID | 70629609 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-ylideneimidazole |
| SMILES | C1=CCC(=C2N=CC=N2)C=C1 |
| InChI | InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-4,6-7H,5H2 |
| InChIKey | RXXKBXHXAIOVJG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-2,4-dien-1-ylideneimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-ylideneimidazole?
The IUPAC name of 2-cyclohexa-2,4-dien-1-ylideneimidazole (CID 70629609) is 2-cyclohexa-2,4-dien-1-ylideneimidazole.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-ylideneimidazole?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-ylideneimidazole is C1=CCC(=C2N=CC=N2)C=C1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-ylideneimidazole?
The InChIKey is RXXKBXHXAIOVJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-4,6-7H,5H2.
What are the key properties of 2-cyclohexa-2,4-dien-1-ylideneimidazole?
2-cyclohexa-2,4-dien-1-ylideneimidazole has a molecular weight of 144.18 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-ylideneimidazole is sourced from PubChem (CID 70629609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).