About 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate
2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate (PubChem CID 70629829) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate.
Molecular Properties
| Compound Name | 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate |
| PubChem CID | 70629829 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate |
| SMILES | CCOC(=O)c1ccc(N)cc1.Nc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C9H11NO2.C8H9NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7;9-7-3-1-2-6(4-7)5-8(10)11/h3-6H,2,10H2,1H3;1-4H,5,9H2,(H,10,11) |
| InChIKey | LVHHUBRIPNSOLL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate?
The IUPAC name of 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate (CID 70629829) is 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate.
What is the SMILES notation for 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate?
The canonical SMILES for 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate is CCOC(=O)c1ccc(N)cc1.Nc1cccc(CC(=O)O)c1.
What is the InChIKey of 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate?
The InChIKey is LVHHUBRIPNSOLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C8H9NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7;9-7-3-1-2-6(4-7)5-8(10)11/h3-6H,2,10H2,1H3;1-4H,5,9H2,(H,10,11).
What are the key properties of 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate?
2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate has a molecular weight of 316.36 g/mol, XLogP of 2.34, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminophenyl)acetic acid;ethyl 4-aminobenzoate is sourced from PubChem (CID 70629829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).