C15H27NO4 — CID 70629846
2-heptyl-1,5-dimethylpyrrolidine-2,5-dicarboxylic acid (PubChem CID 70629846) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-heptyl-1,5-dimethylpyrrolidine-2,5-dicarboxylic acid.
| Compound Name | 2-heptyl-1,5-dimethylpyrrolidine-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70629846 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-heptyl-1,5-dimethylpyrrolidine-2,5-dicarboxylic acid |
| SMILES | CCCCCCCC1(C(=O)O)CCC(C)(C(=O)O)N1C |
| InChI | InChI=1S/C15H27NO4/c1-4-5-6-7-8-9-15(13(19)20)11-10-14(2,12(17)18)16(15)3/h4-11H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | ZKBNUSNRFSFPRR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|