C14H21N3 — CID 70630029
6-methyl-2-pentyl-1,3,3a,7a-tetrahydroindazole-3-carbonitrile (PubChem CID 70630029) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 6-methyl-2-pentyl-1,3,3a,7a-tetrahydroindazole-3-carbonitrile.
| Compound Name | 6-methyl-2-pentyl-1,3,3a,7a-tetrahydroindazole-3-carbonitrile |
|---|---|
| PubChem CID | 70630029 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 6-methyl-2-pentyl-1,3,3a,7a-tetrahydroindazole-3-carbonitrile |
| SMILES | CCCCCN1NC2C=C(C)C=CC2C1C#N |
| InChI | InChI=1S/C14H21N3/c1-3-4-5-8-17-14(10-15)12-7-6-11(2)9-13(12)16-17/h6-7,9,12-14,16H,3-5,8H2,1-2H3 |
| InChIKey | ZQYLYBIRDOGIOK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|