C24H40F2N2O4 — CID 70630129
5-[(2S,3S,4R,5R)-3,4-dipentoxy-5-(pentoxymethyl)oxolan-2-yl]-2,4-difluoropyrimidine (PubChem CID 70630129) has the molecular formula C24H40F2N2O4 and a molecular weight of 458.59 g/mol. Its IUPAC name is 5-[(2S,3S,4R,5R)-3,4-dipentoxy-5-(pentoxymethyl)oxolan-2-yl]-2,4-difluoropyrimidine.
| Compound Name | 5-[(2S,3S,4R,5R)-3,4-dipentoxy-5-(pentoxymethyl)oxolan-2-yl]-2,4-difluoropyrimidine |
|---|---|
| PubChem CID | 70630129 |
| Molecular Formula | C24H40F2N2O4 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 5-[(2S,3S,4R,5R)-3,4-dipentoxy-5-(pentoxymethyl)oxolan-2-yl]-2,4-difluoropyrimidine |
| SMILES | CCCCCOC[C@H]1O[C@@H](c2cnc(F)nc2F)[C@H](OCCCCC)[C@@H]1OCCCCC |
| InChI | InChI=1S/C24H40F2N2O4/c1-4-7-10-13-29-17-19-21(30-14-11-8-5-2)22(31-15-12-9-6-3)20(32-19)18-16-27-24(26)28-23(18)25/h16,19-22H,4-15,17H2,1-3H3/t19-,20+,21-,22+/m1/s1 |
| InChIKey | CSRWBUXGOOOYCM-MBDNFAEBSA-N |
| XLogP | 5.55 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|