C21H33N — CID 70630504
1,1,2-trimethyl-9-pentyl-3,4,4a,5,6,6a-hexahydro-2H-phenanthridine (PubChem CID 70630504) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is 1,1,2-trimethyl-9-pentyl-3,4,4a,5,6,6a-hexahydro-2H-phenanthridine.
| Compound Name | 1,1,2-trimethyl-9-pentyl-3,4,4a,5,6,6a-hexahydro-2H-phenanthridine |
|---|---|
| PubChem CID | 70630504 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 1,1,2-trimethyl-9-pentyl-3,4,4a,5,6,6a-hexahydro-2H-phenanthridine |
| SMILES | CCCCCC1=CC2=C3C(CCC(C)C3(C)C)NCC2C=C1 |
| InChI | InChI=1S/C21H33N/c1-5-6-7-8-16-10-11-17-14-22-19-12-9-15(2)21(3,4)20(19)18(17)13-16/h10-11,13,15,17,19,22H,5-9,12,14H2,1-4H3 |
| InChIKey | LFYFBASDCSYBRW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|