C20H22ClN — CID 70630590
7-chloro-1-methyl-5-(2-methylphenyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine (PubChem CID 70630590) has the molecular formula C20H22ClN and a molecular weight of 311.86 g/mol. Its IUPAC name is 7-chloro-1-methyl-5-(2-methylphenyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine.
| Compound Name | 7-chloro-1-methyl-5-(2-methylphenyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 70630590 |
| Molecular Formula | C20H22ClN |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 7-chloro-1-methyl-5-(2-methylphenyl)-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine |
| SMILES | Cc1ccccc1C1c2cc(Cl)ccc2C2C1CCCN2C |
| InChI | InChI=1S/C20H22ClN/c1-13-6-3-4-7-15(13)19-17-8-5-11-22(2)20(17)16-10-9-14(21)12-18(16)19/h3-4,6-7,9-10,12,17,19-20H,5,8,11H2,1-2H3 |
| InChIKey | YMDCNUAAMRLJDK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |