About 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane
2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane (PubChem CID 70630643) has the molecular formula C10H13ClO2S
and a molecular weight of 232.73 g/mol. Its IUPAC name is 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane.
Molecular Properties
| Compound Name | 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane |
| PubChem CID | 70630643 |
| Molecular Formula | C10H13ClO2S |
| Molecular Weight | 232.73 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane |
| SMILES | C1CC1.Cc1cc(Cl)sc1CC(=O)O |
| InChI | InChI=1S/C7H7ClO2S.C3H6/c1-4-2-6(8)11-5(4)3-7(9)10;1-2-3-1/h2H,3H2,1H3,(H,9,10);1-3H2 |
| InChIKey | XLZKNYQTLOUALQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane?
The IUPAC name of 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane (CID 70630643) is 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane.
What is the SMILES notation for 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane?
The canonical SMILES for 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane is C1CC1.Cc1cc(Cl)sc1CC(=O)O.
What is the InChIKey of 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane?
The InChIKey is XLZKNYQTLOUALQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO2S.C3H6/c1-4-2-6(8)11-5(4)3-7(9)10;1-2-3-1/h2H,3H2,1H3,(H,9,10);1-3H2.
What are the key properties of 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane?
2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane has a molecular weight of 232.73 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-3-methylthiophen-2-yl)acetic acid;cyclopropane is sourced from PubChem (CID 70630643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).