C16H17NO4S — CID 7063081
(3S)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxylic acid (PubChem CID 7063081) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is (3S)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxylic acid.
| Compound Name | (3S)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 7063081 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (3S)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C16H17NO4S/c18-16(19)14-6-3-9-17(11-14)22(20,21)15-8-7-12-4-1-2-5-13(12)10-15/h1-2,4-5,7-8,10,14H,3,6,9,11H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | KTQWWYGLWQVHDM-AWEZNQCLSA-N |
| XLogP | 2.33 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |