C8H9N3O2 — CID 70630980
4-cyclohexa-2,4-dien-1-yl-1,2,4-triazolidine-3,5-dione (PubChem CID 70630980) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 70630980 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1C1C=CC=CC1 |
| InChI | InChI=1S/C8H9N3O2/c12-7-9-10-8(13)11(7)6-4-2-1-3-5-6/h1-4,6H,5H2,(H,9,12)(H,10,13) |
| InChIKey | UYOPGCIBPSJVAT-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |