C13H22N2O — CID 70631093
6-methyl-2-pentyl-4,5,6,7-tetrahydro-1H-indazol-3-one (PubChem CID 70631093) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 6-methyl-2-pentyl-4,5,6,7-tetrahydro-1H-indazol-3-one.
| Compound Name | 6-methyl-2-pentyl-4,5,6,7-tetrahydro-1H-indazol-3-one |
|---|---|
| PubChem CID | 70631093 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 6-methyl-2-pentyl-4,5,6,7-tetrahydro-1H-indazol-3-one |
| SMILES | CCCCCn1[nH]c2c(c1=O)CCC(C)C2 |
| InChI | InChI=1S/C13H22N2O/c1-3-4-5-8-15-13(16)11-7-6-10(2)9-12(11)14-15/h10,14H,3-9H2,1-2H3 |
| InChIKey | PMFHWJFWQSAYMT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|