About 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate
1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate (PubChem CID 70632038) has the molecular formula C21H27NO3
and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate.
Molecular Properties
| Compound Name | 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate |
| PubChem CID | 70632038 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate |
| SMILES | CCc1ccccc1OC(=O)OC(CC)CN(CC)c1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c1-4-17-12-10-11-15-20(17)25-21(23)24-19(5-2)16-22(6-3)18-13-8-7-9-14-18/h7-15,19H,4-6,16H2,1-3H3 |
| InChIKey | IGJYBIBJQQAQLA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate?
The IUPAC name of 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate (CID 70632038) is 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate.
What is the SMILES notation for 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate?
The canonical SMILES for 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate is CCc1ccccc1OC(=O)OC(CC)CN(CC)c1ccccc1.
What is the InChIKey of 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate?
The InChIKey is IGJYBIBJQQAQLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO3/c1-4-17-12-10-11-15-20(17)25-21(23)24-19(5-2)16-22(6-3)18-13-8-7-9-14-18/h7-15,19H,4-6,16H2,1-3H3.
What are the key properties of 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate?
1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate has a molecular weight of 341.45 g/mol, XLogP of 5.07, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(N-ethylanilino)butan-2-yl (2-ethylphenyl) carbonate is sourced from PubChem (CID 70632038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).