C9H6F2N2S — CID 706326
4-(3,4-difluorophenyl)-1,3-thiazol-2-amine (PubChem CID 706326) has the molecular formula C9H6F2N2S and a molecular weight of 212.22 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-difluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 706326 |
| Molecular Formula | C9H6F2N2S |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 4-(3,4-difluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C9H6F2N2S/c10-6-2-1-5(3-7(6)11)8-4-14-9(12)13-8/h1-4H,(H2,12,13) |
| InChIKey | NDCSJUJQMRFHEX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |