C28H26Cl2N4O6 — CID 70633334
tert-butyl N-[1-[3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 70633334) has the molecular formula C28H26Cl2N4O6 and a molecular weight of 585.44 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70633334 |
| Molecular Formula | C28H26Cl2N4O6 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | tert-butyl N-[1-[3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2,5-dioxoimidazolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)N1C(=O)CN(N=Cc2ccc(-c3ccc(Cl)c(Cl)c3)o2)C1=O |
| InChI | InChI=1S/C28H26Cl2N4O6/c1-28(2,3)40-26(37)32-22(13-17-7-5-4-6-8-17)25(36)34-24(35)16-33(27(34)38)31-15-19-10-12-23(39-19)18-9-11-20(29)21(30)14-18/h4-12,14-15,22H,13,16H2,1-3H3,(H,32,37) |
| InChIKey | MTQCYVCJIGFTSX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|