C16H21N — CID 70633464
(3S,8S)-5,10-dimethyl-5-azatricyclo[9.4.0.03,8]pentadeca-1(15),9,11,13-tetraene (PubChem CID 70633464) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (3S,8S)-5,10-dimethyl-5-azatricyclo[9.4.0.03,8]pentadeca-1(15),9,11,13-tetraene.
| Compound Name | (3S,8S)-5,10-dimethyl-5-azatricyclo[9.4.0.03,8]pentadeca-1(15),9,11,13-tetraene |
|---|---|
| PubChem CID | 70633464 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3S,8S)-5,10-dimethyl-5-azatricyclo[9.4.0.03,8]pentadeca-1(15),9,11,13-tetraene |
| SMILES | CC1=C[C@@H]2CCN(C)C[C@H]2Cc2ccccc21 |
| InChI | InChI=1S/C16H21N/c1-12-9-13-7-8-17(2)11-15(13)10-14-5-3-4-6-16(12)14/h3-6,9,13,15H,7-8,10-11H2,1-2H3/t13-,15+/m0/s1 |
| InChIKey | KFODZQVVUHSMEA-DZGCQCFKSA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |