About 2,4-dimethylaniline;methanol
2,4-dimethylaniline;methanol (PubChem CID 70633605) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 2,4-dimethylaniline;methanol.
Molecular Properties
| Compound Name | 2,4-dimethylaniline;methanol |
| PubChem CID | 70633605 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2,4-dimethylaniline;methanol |
| SMILES | CO.Cc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C8H11N.CH4O/c1-6-3-4-8(9)7(2)5-6;1-2/h3-5H,9H2,1-2H3;2H,1H3 |
| InChIKey | QIFOHZLTNPWZKU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylaniline;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylaniline;methanol?
The IUPAC name of 2,4-dimethylaniline;methanol (CID 70633605) is 2,4-dimethylaniline;methanol.
What is the SMILES notation for 2,4-dimethylaniline;methanol?
The canonical SMILES for 2,4-dimethylaniline;methanol is CO.Cc1ccc(N)c(C)c1.
What is the InChIKey of 2,4-dimethylaniline;methanol?
The InChIKey is QIFOHZLTNPWZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.CH4O/c1-6-3-4-8(9)7(2)5-6;1-2/h3-5H,9H2,1-2H3;2H,1H3.
What are the key properties of 2,4-dimethylaniline;methanol?
2,4-dimethylaniline;methanol has a molecular weight of 153.22 g/mol, XLogP of 1.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylaniline;methanol is sourced from PubChem (CID 70633605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).