About 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one
1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one (PubChem CID 70633655) has the molecular formula C18H33N3O3
and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one.
Molecular Properties
| Compound Name | 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one |
| PubChem CID | 70633655 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one |
| SMILES | NC(=O)CCCC1(C(N)=O)CCCCCC1.O=C1CCCCCN1 |
| InChI | InChI=1S/C12H22N2O2.C6H11NO/c13-10(15)6-5-9-12(11(14)16)7-3-1-2-4-8-12;8-6-4-2-1-3-5-7-6/h1-9H2,(H2,13,15)(H2,14,16);1-5H2,(H,7,8) |
| InChIKey | GMTZWBBICQCDKM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one?
The IUPAC name of 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one (CID 70633655) is 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one.
What is the SMILES notation for 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one?
The canonical SMILES for 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one is NC(=O)CCCC1(C(N)=O)CCCCCC1.O=C1CCCCCN1.
What is the InChIKey of 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one?
The InChIKey is GMTZWBBICQCDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2.C6H11NO/c13-10(15)6-5-9-12(11(14)16)7-3-1-2-4-8-12;8-6-4-2-1-3-5-7-6/h1-9H2,(H2,13,15)(H2,14,16);1-5H2,(H,7,8).
What are the key properties of 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one?
1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one has a molecular weight of 339.48 g/mol, XLogP of 2.14, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-4-oxobutyl)cycloheptane-1-carboxamide;azepan-2-one is sourced from PubChem (CID 70633655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).