C24H35NO3 — CID 70633918
[(1S,2S,5S,9S,10R,13R,15S)-5-methyl-6-oxo-12-(prop-2-enylamino)-15-pentacyclo[11.4.1.01,13.02,10.05,9]octadecanyl] acetate (PubChem CID 70633918) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is [(1S,2S,5S,9S,10R,13R,15S)-5-methyl-6-oxo-12-(prop-2-enylamino)-15-pentacyclo[11.4.1.01,13.02,10.05,9]octadecanyl] acetate.
| Compound Name | [(1S,2S,5S,9S,10R,13R,15S)-5-methyl-6-oxo-12-(prop-2-enylamino)-15-pentacyclo[11.4.1.01,13.02,10.05,9]octadecanyl] acetate |
|---|---|
| PubChem CID | 70633918 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | [(1S,2S,5S,9S,10R,13R,15S)-5-methyl-6-oxo-12-(prop-2-enylamino)-15-pentacyclo[11.4.1.01,13.02,10.05,9]octadecanyl] acetate |
| SMILES | C=CCNC1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]23CC[C@H](OC(C)=O)C[C@@]12C3 |
| InChI | InChI=1S/C24H35NO3/c1-4-11-25-20-12-17-18-5-6-21(27)22(18,3)9-8-19(17)23-10-7-16(28-15(2)26)13-24(20,23)14-23/h4,16-20,25H,1,5-14H2,2-3H3/t16-,17-,18-,19-,20?,22-,23-,24+/m0/s1 |
| InChIKey | KPKLVWAHXBAIIU-RWYUMSFESA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|