About copper;3-(4-propan-2-yloxyphenyl)propan-1-ol
copper;3-(4-propan-2-yloxyphenyl)propan-1-ol (PubChem CID 70633990) has the molecular formula C12H18CuO2
and a molecular weight of 257.82 g/mol. Its IUPAC name is copper;3-(4-propan-2-yloxyphenyl)propan-1-ol.
Molecular Properties
| Compound Name | copper;3-(4-propan-2-yloxyphenyl)propan-1-ol |
| PubChem CID | 70633990 |
| Molecular Formula | C12H18CuO2 |
| Molecular Weight | 257.82 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | copper;3-(4-propan-2-yloxyphenyl)propan-1-ol |
| SMILES | CC(C)Oc1ccc(CCCO)cc1.[Cu] |
| InChI | InChI=1S/C12H18O2.Cu/c1-10(2)14-12-7-5-11(6-8-12)4-3-9-13;/h5-8,10,13H,3-4,9H2,1-2H3; |
| InChIKey | QBJXJGQFOLFTAH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;3-(4-propan-2-yloxyphenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;3-(4-propan-2-yloxyphenyl)propan-1-ol?
The IUPAC name of copper;3-(4-propan-2-yloxyphenyl)propan-1-ol (CID 70633990) is copper;3-(4-propan-2-yloxyphenyl)propan-1-ol.
What is the SMILES notation for copper;3-(4-propan-2-yloxyphenyl)propan-1-ol?
The canonical SMILES for copper;3-(4-propan-2-yloxyphenyl)propan-1-ol is CC(C)Oc1ccc(CCCO)cc1.[Cu].
What is the InChIKey of copper;3-(4-propan-2-yloxyphenyl)propan-1-ol?
The InChIKey is QBJXJGQFOLFTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2.Cu/c1-10(2)14-12-7-5-11(6-8-12)4-3-9-13;/h5-8,10,13H,3-4,9H2,1-2H3;.
What are the key properties of copper;3-(4-propan-2-yloxyphenyl)propan-1-ol?
copper;3-(4-propan-2-yloxyphenyl)propan-1-ol has a molecular weight of 257.82 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;3-(4-propan-2-yloxyphenyl)propan-1-ol is sourced from PubChem (CID 70633990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).