C15H21NO — CID 70634014
bicyclo[3.1.0]hexa-1(6),2,4-triene;3-propyl-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole (PubChem CID 70634014) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;3-propyl-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;3-propyl-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 70634014 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;3-propyl-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole |
| SMILES | CCCC1OCC2CNCC21.c1cc2cc-2c1 |
| InChI | InChI=1S/C9H17NO.C6H4/c1-2-3-9-8-5-10-4-7(8)6-11-9;1-2-5-4-6(5)3-1/h7-10H,2-6H2,1H3;1-4H |
| InChIKey | BXDPDVPZFUOWCD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |