About 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile
1,6-diaminocyclohexa-2,4-diene-1-carbonitrile (PubChem CID 70634051) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 70634051 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile |
| SMILES | N#CC1(N)C=CC=CC1N |
| InChI | InChI=1S/C7H9N3/c8-5-7(10)4-2-1-3-6(7)9/h1-4,6H,9-10H2 |
| InChIKey | AMTGACGDBJEBPJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile (CID 70634051) is 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile is N#CC1(N)C=CC=CC1N.
What is the InChIKey of 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is AMTGACGDBJEBPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c8-5-7(10)4-2-1-3-6(7)9/h1-4,6H,9-10H2.
What are the key properties of 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile?
1,6-diaminocyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 135.17 g/mol, XLogP of -0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diaminocyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 70634051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).