About 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide
1,6-diaminocyclohexa-2,4-diene-1-sulfonamide (PubChem CID 70634146) has the molecular formula C6H11N3O2S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 70634146 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide |
| SMILES | NC1C=CC=CC1(N)S(N)(=O)=O |
| InChI | InChI=1S/C6H11N3O2S/c7-5-3-1-2-4-6(5,8)12(9,10)11/h1-5H,7-8H2,(H2,9,10,11) |
| InChIKey | UBUZHQHQFLSCQT-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide (CID 70634146) is 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide is NC1C=CC=CC1(N)S(N)(=O)=O.
What is the InChIKey of 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is UBUZHQHQFLSCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2S/c7-5-3-1-2-4-6(5,8)12(9,10)11/h1-5H,7-8H2,(H2,9,10,11).
What are the key properties of 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide?
1,6-diaminocyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 189.24 g/mol, XLogP of -1.62, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diaminocyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 70634146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).