About copper;10H-phenothiazine;hydrochloride
copper;10H-phenothiazine;hydrochloride (PubChem CID 70634229) has the molecular formula C12H10ClCuNS
and a molecular weight of 299.29 g/mol. Its IUPAC name is copper;10H-phenothiazine;hydrochloride.
Molecular Properties
| Compound Name | copper;10H-phenothiazine;hydrochloride |
| PubChem CID | 70634229 |
| Molecular Formula | C12H10ClCuNS |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | copper;10H-phenothiazine;hydrochloride |
| SMILES | Cl.[Cu].c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NS.ClH.Cu/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;;/h1-8,13H;1H; |
| InChIKey | ZUQQOHYIQYNTSO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze copper;10H-phenothiazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;10H-phenothiazine;hydrochloride?
The IUPAC name of copper;10H-phenothiazine;hydrochloride (CID 70634229) is copper;10H-phenothiazine;hydrochloride.
What is the SMILES notation for copper;10H-phenothiazine;hydrochloride?
The canonical SMILES for copper;10H-phenothiazine;hydrochloride is Cl.[Cu].c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of copper;10H-phenothiazine;hydrochloride?
The InChIKey is ZUQQOHYIQYNTSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS.ClH.Cu/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;;/h1-8,13H;1H;.
What are the key properties of copper;10H-phenothiazine;hydrochloride?
copper;10H-phenothiazine;hydrochloride has a molecular weight of 299.29 g/mol, XLogP of 4.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;10H-phenothiazine;hydrochloride is sourced from PubChem (CID 70634229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).