C11H21ClN4 — CID 70634486
4,6-dibutyl-2-chloro-2H-1,3,5-triazin-1-amine (PubChem CID 70634486) has the molecular formula C11H21ClN4 and a molecular weight of 244.77 g/mol. Its IUPAC name is 4,6-dibutyl-2-chloro-2H-1,3,5-triazin-1-amine.
| Compound Name | 4,6-dibutyl-2-chloro-2H-1,3,5-triazin-1-amine |
|---|---|
| PubChem CID | 70634486 |
| Molecular Formula | C11H21ClN4 |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 4,6-dibutyl-2-chloro-2H-1,3,5-triazin-1-amine |
| SMILES | CCCCC1=NC(Cl)N(N)C(CCCC)=N1 |
| InChI | InChI=1S/C11H21ClN4/c1-3-5-7-9-14-10(8-6-4-2)16(13)11(12)15-9/h11H,3-8,13H2,1-2H3 |
| InChIKey | QEQRNOUYKSIWFK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|