About 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid
2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid (PubChem CID 70635112) has the molecular formula C15H19FN2O2S
and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid |
| PubChem CID | 70635112 |
| Molecular Formula | C15H19FN2O2S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid |
| SMILES | CCC(C(=O)O)C1C(C)S/C(=N\c2ccccc2F)N1C |
| InChI | InChI=1S/C15H19FN2O2S/c1-4-10(14(19)20)13-9(2)21-15(18(13)3)17-12-8-6-5-7-11(12)16/h5-10,13H,4H2,1-3H3,(H,19,20)/b17-15- |
| InChIKey | NCFFEKMJMCHPGS-ICFOKQHNSA-N |
| XLogP | 3.36 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid?
The IUPAC name of 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid (CID 70635112) is 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid.
What is the SMILES notation for 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid?
The canonical SMILES for 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid is CCC(C(=O)O)C1C(C)S/C(=N\c2ccccc2F)N1C.
What is the InChIKey of 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid?
The InChIKey is NCFFEKMJMCHPGS-ICFOKQHNSA-N. The full InChI is InChI=1S/C15H19FN2O2S/c1-4-10(14(19)20)13-9(2)21-15(18(13)3)17-12-8-6-5-7-11(12)16/h5-10,13H,4H2,1-3H3,(H,19,20)/b17-15-.
What are the key properties of 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid?
2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid has a molecular weight of 310.39 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-fluorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]butanoic acid is sourced from PubChem (CID 70635112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).