About (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate
(2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate (PubChem CID 70635186) has the molecular formula C16H26ClN2O3PS
and a molecular weight of 392.89 g/mol. Its IUPAC name is (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate.
Molecular Properties
| Compound Name | (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate |
| PubChem CID | 70635186 |
| Molecular Formula | C16H26ClN2O3PS |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate |
| SMILES | CCCSP(=NCCCl)(OCC)OC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C16H26ClN2O3PS/c1-3-14-24-23(21-4-2,19-13-11-17)22-16(20)18-12-10-15-8-6-5-7-9-15/h5-9H,3-4,10-14H2,1-2H3,(H,18,20) |
| InChIKey | OGYBYSSYKJIOEM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate?
The IUPAC name of (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate (CID 70635186) is (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate.
What is the SMILES notation for (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate?
The canonical SMILES for (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate is CCCSP(=NCCCl)(OCC)OC(=O)NCCc1ccccc1.
What is the InChIKey of (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate?
The InChIKey is OGYBYSSYKJIOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26ClN2O3PS/c1-3-14-24-23(21-4-2,19-13-11-17)22-16(20)18-12-10-15-8-6-5-7-9-15/h5-9H,3-4,10-14H2,1-2H3,(H,18,20).
What are the key properties of (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate?
(2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate has a molecular weight of 392.89 g/mol, XLogP of 5.32, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloroethylimino-ethoxy-propylsulfanyl-λ5-phosphanyl) N-(2-phenylethyl)carbamate is sourced from PubChem (CID 70635186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).