C14H20N2O5S — CID 70635533
tert-butyl (6R)-3-acetyl-7-amino-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70635533) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is tert-butyl (6R)-3-acetyl-7-amino-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R)-3-acetyl-7-amino-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70635533 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | tert-butyl (6R)-3-acetyl-7-amino-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC1(N)C(=O)N2C(C(=O)OC(C)(C)C)=C(C(C)=O)CS[C@@H]21 |
| InChI | InChI=1S/C14H20N2O5S/c1-7(17)8-6-22-12-14(15,20-5)11(19)16(12)9(8)10(18)21-13(2,3)4/h12H,6,15H2,1-5H3/t12-,14?/m1/s1 |
| InChIKey | UVQFKQKBUUZWCX-PUODRLBUSA-N |
| XLogP | 0.39 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|