About N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine
N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine (PubChem CID 70635703) has the molecular formula C17H29N
and a molecular weight of 247.43 g/mol. Its IUPAC name is N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine |
| PubChem CID | 70635703 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine |
| SMILES | C=CC1=C(NC2CCCCC2)C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H29N/c1-5-14-12-17(3,4)11-13(2)16(14)18-15-9-7-6-8-10-15/h5,13,15,18H,1,6-12H2,2-4H3 |
| InChIKey | RBUOOLZICZROSY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine?
The IUPAC name of N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine (CID 70635703) is N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine.
What is the SMILES notation for N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine?
The canonical SMILES for N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine is C=CC1=C(NC2CCCCC2)C(C)CC(C)(C)C1.
What is the InChIKey of N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine?
The InChIKey is RBUOOLZICZROSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N/c1-5-14-12-17(3,4)11-13(2)16(14)18-15-9-7-6-8-10-15/h5,13,15,18H,1,6-12H2,2-4H3.
What are the key properties of N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine?
N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine has a molecular weight of 247.43 g/mol, XLogP of 4.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-ethenyl-4,4,6-trimethylcyclohexen-1-amine is sourced from PubChem (CID 70635703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).