C13H14Cl2N2O2S — CID 70635786
2-[2-(3,5-dichlorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]acetic acid (PubChem CID 70635786) has the molecular formula C13H14Cl2N2O2S and a molecular weight of 333.24 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]acetic acid.
| Compound Name | 2-[2-(3,5-dichlorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 70635786 |
| Molecular Formula | C13H14Cl2N2O2S |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)imino-3,5-dimethyl-1,3-thiazolidin-4-yl]acetic acid |
| SMILES | CC1S/C(=N\c2cc(Cl)cc(Cl)c2)N(C)C1CC(=O)O |
| InChI | InChI=1S/C13H14Cl2N2O2S/c1-7-11(6-12(18)19)17(2)13(20-7)16-10-4-8(14)3-9(15)5-10/h3-5,7,11H,6H2,1-2H3,(H,18,19)/b16-13- |
| InChIKey | DYWFDAJFGDPHCQ-SSZFMOIBSA-N |
| XLogP | 3.89 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|