C22H40O3 — CID 70636400
9-[(1S,2R)-2-(1-hydroxyoctyl)cyclopent-3-en-1-yl]nonanoic acid (PubChem CID 70636400) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is 9-[(1S,2R)-2-(1-hydroxyoctyl)cyclopent-3-en-1-yl]nonanoic acid.
| Compound Name | 9-[(1S,2R)-2-(1-hydroxyoctyl)cyclopent-3-en-1-yl]nonanoic acid |
|---|---|
| PubChem CID | 70636400 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 9-[(1S,2R)-2-(1-hydroxyoctyl)cyclopent-3-en-1-yl]nonanoic acid |
| SMILES | CCCCCCCC(O)[C@H]1C=CC[C@@H]1CCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H40O3/c1-2-3-4-7-11-17-21(23)20-16-13-15-19(20)14-10-8-5-6-9-12-18-22(24)25/h13,16,19-21,23H,2-12,14-15,17-18H2,1H3,(H,24,25)/t19-,20-,21?/m0/s1 |
| InChIKey | AMAOEQIEMJBDMD-AHTKWCMKSA-N |
| XLogP | 6.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|