C6H14N6 — CID 70636497
4-N',4-N'-dimethyl-1H-pyrimidine-2,4,4,6-tetramine (PubChem CID 70636497) has the molecular formula C6H14N6 and a molecular weight of 170.22 g/mol. Its IUPAC name is 4-N',4-N'-dimethyl-1H-pyrimidine-2,4,4,6-tetramine.
| Compound Name | 4-N',4-N'-dimethyl-1H-pyrimidine-2,4,4,6-tetramine |
|---|---|
| PubChem CID | 70636497 |
| Molecular Formula | C6H14N6 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 4-N',4-N'-dimethyl-1H-pyrimidine-2,4,4,6-tetramine |
| SMILES | CN(C)C1(N)C=C(N)NC(N)=N1 |
| InChI | InChI=1S/C6H14N6/c1-12(2)6(9)3-4(7)10-5(8)11-6/h3H,7,9H2,1-2H3,(H3,8,10,11) |
| InChIKey | CPDMFQOVEXIIMC-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|