C12H7ClN2O2 — CID 70636824
10-chloro-1,9-dihydropyrido[3,2-g]quinoline-4,6-dione (PubChem CID 70636824) has the molecular formula C12H7ClN2O2 and a molecular weight of 246.65 g/mol. Its IUPAC name is 10-chloro-1,9-dihydropyrido[3,2-g]quinoline-4,6-dione.
| Compound Name | 10-chloro-1,9-dihydropyrido[3,2-g]quinoline-4,6-dione |
|---|---|
| PubChem CID | 70636824 |
| Molecular Formula | C12H7ClN2O2 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 10-chloro-1,9-dihydropyrido[3,2-g]quinoline-4,6-dione |
| SMILES | O=c1cc[nH]c2c(Cl)c3[nH]ccc(=O)c3cc12 |
| InChI | InChI=1S/C12H7ClN2O2/c13-10-11-6(8(16)1-3-14-11)5-7-9(17)2-4-15-12(7)10/h1-5H,(H,14,16)(H,15,17) |
| InChIKey | HWMPIGMHSMODNG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|