About 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide
4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide (PubChem CID 70637086) has the molecular formula C7H7O4PS
and a molecular weight of 218.17 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide.
Molecular Properties
| Compound Name | 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide |
| PubChem CID | 70637086 |
| Molecular Formula | C7H7O4PS |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide |
| SMILES | Cc1ccccc1OP1(=O)OSO1 |
| InChI | InChI=1S/C7H7O4PS/c1-6-4-2-3-5-7(6)9-12(8)10-13-11-12/h2-5H,1H3 |
| InChIKey | UTXYDZUGYZTVOW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide?
The IUPAC name of 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide (CID 70637086) is 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide.
What is the SMILES notation for 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide?
The canonical SMILES for 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide is Cc1ccccc1OP1(=O)OSO1.
What is the InChIKey of 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide?
The InChIKey is UTXYDZUGYZTVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O4PS/c1-6-4-2-3-5-7(6)9-12(8)10-13-11-12/h2-5H,1H3.
What are the key properties of 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide?
4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide has a molecular weight of 218.17 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenoxy)-1,3,2,4λ5-dioxathiaphosphetane 4-oxide is sourced from PubChem (CID 70637086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).