C18H25N — CID 70637124
11-(2-methylbut-3-en-2-yl)-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene (PubChem CID 70637124) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is 11-(2-methylbut-3-en-2-yl)-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene.
| Compound Name | 11-(2-methylbut-3-en-2-yl)-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 70637124 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 11-(2-methylbut-3-en-2-yl)-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene |
| SMILES | C=CC(C)(C)N1CCC2CC(Cc3ccccc32)C1 |
| InChI | InChI=1S/C18H25N/c1-4-18(2,3)19-10-9-16-12-14(13-19)11-15-7-5-6-8-17(15)16/h4-8,14,16H,1,9-13H2,2-3H3 |
| InChIKey | WDDAPUWIKWENGK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|