C21H17NO3 — CID 70637125
2-[[4-(2-methylphenyl)phenyl]carbamoyl]benzoic acid (PubChem CID 70637125) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[[4-(2-methylphenyl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-(2-methylphenyl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 70637125 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-[[4-(2-methylphenyl)phenyl]carbamoyl]benzoic acid |
| SMILES | Cc1ccccc1-c1ccc(NC(=O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H17NO3/c1-14-6-2-3-7-17(14)15-10-12-16(13-11-15)22-20(23)18-8-4-5-9-19(18)21(24)25/h2-13H,1H3,(H,22,23)(H,24,25) |
| InChIKey | OCINBQGTUQDAKW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |