C14H20N4 — CID 70637229
4-[1-(1,4-diaminocyclohexa-2,4-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1,4-diamine (PubChem CID 70637229) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-[1-(1,4-diaminocyclohexa-2,4-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-[1-(1,4-diaminocyclohexa-2,4-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 70637229 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-[1-(1,4-diaminocyclohexa-2,4-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1,4-diamine |
| SMILES | C=C(C1(N)C=CC(N)=CC1)C1(N)C=CC(N)=CC1 |
| InChI | InChI=1S/C14H20N4/c1-10(13(17)6-2-11(15)3-7-13)14(18)8-4-12(16)5-9-14/h2-6,8H,1,7,9,15-18H2 |
| InChIKey | ZHRPVUPCFJRLKZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|