C25H22Cl2O6 — CID 70637232
2,3-bis(5-chloro-2-methylbenzoyl)benzoic acid;ethane-1,2-diol (PubChem CID 70637232) has the molecular formula C25H22Cl2O6 and a molecular weight of 489.35 g/mol. Its IUPAC name is 2,3-bis(5-chloro-2-methylbenzoyl)benzoic acid;ethane-1,2-diol.
| Compound Name | 2,3-bis(5-chloro-2-methylbenzoyl)benzoic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 70637232 |
| Molecular Formula | C25H22Cl2O6 |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 2,3-bis(5-chloro-2-methylbenzoyl)benzoic acid;ethane-1,2-diol |
| SMILES | Cc1ccc(Cl)cc1C(=O)c1cccc(C(=O)O)c1C(=O)c1cc(Cl)ccc1C.OCCO |
| InChI | InChI=1S/C23H16Cl2O4.C2H6O2/c1-12-6-8-14(24)10-18(12)21(26)16-4-3-5-17(23(28)29)20(16)22(27)19-11-15(25)9-7-13(19)2;3-1-2-4/h3-11H,1-2H3,(H,28,29);3-4H,1-2H2 |
| InChIKey | PLRPKXGTQQJRIZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |